What is the structure of benzo?
Benzodiazepine
| PubChem CID | 134664 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H8N2 |
| Synonyms | Benzodiazepine 1H-1,2-benzodiazepine 1,2-Benzodiazepine benzodiazepin 12794-10-4 More… |
| Molecular Weight | 144.17 |
Which heterocyclic ring is present in alprazolam?
Alprazolam, 8-chloro-1-methyl-6-phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepine (5.1. 39), is a chemical analog of triazolam (4.2. 4) that differs by the absence of a chlorine atom in the o-position of the 6-phenyl ring.
How are benzodiazepines metabolized?
Metabolism. All benzodiazepines are metabolized by the liver. However, some benzodiazepines (i.e. – lorazepam, oxazepam, and tamazepam) do not go through cytochrome P450 metabolism (Phase I metabolism), and are only metabolized via glucuronidation (Phase II metabolism).
What is the Iupac name of benzophenone?
diphenylmethanone
| IUPAC Name | diphenylmethanone |
|---|---|
| Alternative Names | BENZOPHENONE diphenylmethanone Diphenyl ketone |
| Molecular Formula | C13H10O |
| Molar Mass | 182.222 g/mol |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
What is the mechanism of action of alprazolam?
The exact mechanism of action of alprazolam is unknown. Benzodiazepines bind to gamma aminobutyric acid (GABA) receptors in the brain and enhance GABA-mediated synaptic inhibition; such actions may be responsible for the efficacy of alprazolam in anxiety disorder and panic disorder.
What is the molecular formula of alprazolam?
C17H13ClN4Alprazolam / Formula
How does alprazolam work in the brain?
Xanax works by increasing the effects of a brain chemical called gamma-aminobutyric acid (GABA), which promotes calmness and produces a relaxed feeling. The drug decreases the level of excitement in the brain to treat anxiety and panic disorders.
What are the metabolites of benzodiazepine?
Benzodiazepines are extensively metabolized, and the parent compounds are not detected in urine. Diazepam is metabolized to nordiazepam, oxazepam, and temazepam; all may be detected after diazepam use. Chlordiazepoxide is metabolized to nordiazepam and oxazepam; all may be detected after chlordiazepoxide use.